C24H24ClN3O3S — CID 56859964
(3S,7S,8aS)-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-3-[(4-methoxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 56859964) has the molecular formula C24H24ClN3O3S and a molecular weight of 469.99 g/mol. Its IUPAC name is (3S,7S,8aS)-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-3-[(4-methoxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,7S,8aS)-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-3-[(4-methoxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 56859964 |
| Molecular Formula | C24H24ClN3O3S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (3S,7S,8aS)-7-[(3-chloro-1-benzothiophen-2-yl)methylamino]-3-[(4-methoxyphenyl)methyl]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | COc1ccc(C[C@@H]2NC(=O)[C@@H]3C[C@H](NCc4sc5ccccc5c4Cl)CN3C2=O)cc1 |
| InChI | InChI=1S/C24H24ClN3O3S/c1-31-16-8-6-14(7-9-16)10-18-24(30)28-13-15(11-19(28)23(29)27-18)26-12-21-22(25)17-4-2-3-5-20(17)32-21/h2-9,15,18-19,26H,10-13H2,1H3,(H,27,29)/t15-,18-,19-/m0/s1 |
| InChIKey | XOLCWBXVDQTPTB-SNRMKQJTSA-N |
| XLogP | 3.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |