C21H34N2O2S — CID 126467126
(4aR,8aR)-1-(3-phenylbutyl)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 126467126) has the molecular formula C21H34N2O2S and a molecular weight of 378.58 g/mol. Its IUPAC name is (4aR,8aR)-1-(3-phenylbutyl)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | (4aR,8aR)-1-(3-phenylbutyl)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 126467126 |
| Molecular Formula | C21H34N2O2S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (4aR,8aR)-1-(3-phenylbutyl)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CC(CCN1CCC[C@@H]2CN(S(=O)(=O)C(C)C)CC[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C21H34N2O2S/c1-17(2)26(24,25)23-15-12-21-20(16-23)10-7-13-22(21)14-11-18(3)19-8-5-4-6-9-19/h4-6,8-9,17-18,20-21H,7,10-16H2,1-3H3/t18?,20-,21-/m1/s1 |
| InChIKey | HPKJRIYXGAHEHS-VTVVEXCCSA-N |
| XLogP | 3.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |