C14H26N2O3S2 — CID 126467724
1-[(4aR,8aR)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-methylsulfanylethanone (PubChem CID 126467724) has the molecular formula C14H26N2O3S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-[(4aR,8aR)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-methylsulfanylethanone.
| Compound Name | 1-[(4aR,8aR)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-methylsulfanylethanone |
|---|---|
| PubChem CID | 126467724 |
| Molecular Formula | C14H26N2O3S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(4aR,8aR)-6-propan-2-ylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-methylsulfanylethanone |
| SMILES | CSCC(=O)N1CCC[C@@H]2CN(S(=O)(=O)C(C)C)CC[C@H]21 |
| InChI | InChI=1S/C14H26N2O3S2/c1-11(2)21(18,19)15-8-6-13-12(9-15)5-4-7-16(13)14(17)10-20-3/h11-13H,4-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | GVJHSOVFBVTVBS-CHWSQXEVSA-N |
| XLogP | 1.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |