C19H29N3O3S2 — CID 26341449
(4aR,8aS)-N,N-dimethyl-1-[2-(4-methylsulfanylphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide (PubChem CID 26341449) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (4aR,8aS)-N,N-dimethyl-1-[2-(4-methylsulfanylphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide.
| Compound Name | (4aR,8aS)-N,N-dimethyl-1-[2-(4-methylsulfanylphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide |
|---|---|
| PubChem CID | 26341449 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (4aR,8aS)-N,N-dimethyl-1-[2-(4-methylsulfanylphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide |
| SMILES | CSc1ccc(CC(=O)N2CCC[C@@H]3CN(S(=O)(=O)N(C)C)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H29N3O3S2/c1-20(2)27(24,25)21-12-10-18-16(14-21)5-4-11-22(18)19(23)13-15-6-8-17(26-3)9-7-15/h6-9,16,18H,4-5,10-14H2,1-3H3/t16-,18+/m1/s1 |
| InChIKey | GIHNGMDZIKTWEU-AEFFLSMTSA-N |
| XLogP | 2.07 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |