C23H33N5O3S — CID 133134087
(4aS,8aR)-1-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide (PubChem CID 133134087) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is (4aS,8aR)-1-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide.
| Compound Name | (4aS,8aR)-1-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide |
|---|---|
| PubChem CID | 133134087 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (4aS,8aR)-1-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-N,N-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-sulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)N1CCC[C@H]2CN(S(=O)(=O)N(C)C)CC[C@H]21 |
| InChI | InChI=1S/C23H33N5O3S/c1-17-21(18(2)28(24-17)20-10-6-5-7-11-20)15-23(29)27-13-8-9-19-16-26(14-12-22(19)27)32(30,31)25(3)4/h5-7,10-11,19,22H,8-9,12-16H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | AXTGEXYDPQZNTM-SIKLNZKXSA-N |
| XLogP | 2.15 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |