C17H21F3N2O3S — CID 133133657
1-[(4aS,8aR)-6-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone (PubChem CID 133133657) has the molecular formula C17H21F3N2O3S and a molecular weight of 390.43 g/mol. Its IUPAC name is 1-[(4aS,8aR)-6-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-[(4aS,8aR)-6-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 133133657 |
| Molecular Formula | C17H21F3N2O3S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-[(4aS,8aR)-6-methylsulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone |
| SMILES | CS(=O)(=O)N1CC[C@@H]2[C@@H](CCCN2C(=O)Cc2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H21F3N2O3S/c1-26(24,25)21-6-4-15-12(10-21)3-2-5-22(15)16(23)9-11-7-13(18)17(20)14(19)8-11/h7-8,12,15H,2-6,9-10H2,1H3/t12-,15+/m0/s1 |
| InChIKey | MLFMBPFGVDGLSU-SWLSCSKDSA-N |
| XLogP | 1.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|