C20H32N4O — CID 126467235
[(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone (PubChem CID 126467235) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is [(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone.
| Compound Name | [(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 126467235 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | [(4aR,8aS)-6-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-cyclohexylmethanone |
| SMILES | Cc1[nH]cnc1CN1CC[C@H]2[C@H](CCCN2C(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C20H32N4O/c1-15-18(22-14-21-15)13-23-11-9-19-17(12-23)8-5-10-24(19)20(25)16-6-3-2-4-7-16/h14,16-17,19H,2-13H2,1H3,(H,21,22)/t17-,19+/m1/s1 |
| InChIKey | YQHMZOZIYUTKRI-MJGOQNOKSA-N |
| XLogP | 3.11 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |