C14H16N4O2S — CID 126468463
N,N-diethyl-2-(9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)acetamide (PubChem CID 126468463) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N,N-diethyl-2-(9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)acetamide.
| Compound Name | N,N-diethyl-2-(9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)acetamide |
|---|---|
| PubChem CID | 126468463 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N,N-diethyl-2-(9-oxo-3-thia-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),4,7,11-tetraen-10-yl)acetamide |
| SMILES | CCN(CC)C(=O)Cn1ncn2c(cc3ccsc32)c1=O |
| InChI | InChI=1S/C14H16N4O2S/c1-3-16(4-2)12(19)8-18-13(20)11-7-10-5-6-21-14(10)17(11)9-15-18/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | NLRVVPHXEAHPMW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |