C16H24N2O6 — CID 126468859
N-[2-[(3-methylcyclohexyl)amino]ethyl]furan-2-carboxamide;oxalic acid (PubChem CID 126468859) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[2-[(3-methylcyclohexyl)amino]ethyl]furan-2-carboxamide;oxalic acid.
| Compound Name | N-[2-[(3-methylcyclohexyl)amino]ethyl]furan-2-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 126468859 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[2-[(3-methylcyclohexyl)amino]ethyl]furan-2-carboxamide;oxalic acid |
| SMILES | CC1CCCC(NCCNC(=O)c2ccco2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H22N2O2.C2H2O4/c1-11-4-2-5-12(10-11)15-7-8-16-14(17)13-6-3-9-18-13;3-1(4)2(5)6/h3,6,9,11-12,15H,2,4-5,7-8,10H2,1H3,(H,16,17);(H,3,4)(H,5,6) |
| InChIKey | RFZUNJQMDBFPCQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|