C14H19F3N2O2 — CID 99625244
N-[2-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]furan-2-carboxamide (PubChem CID 99625244) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[2-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 99625244 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[2-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCN[C@H]1CCC[C@@H](C(F)(F)F)C1)c1ccco1 |
| InChI | InChI=1S/C14H19F3N2O2/c15-14(16,17)10-3-1-4-11(9-10)18-6-7-19-13(20)12-5-2-8-21-12/h2,5,8,10-11,18H,1,3-4,6-7,9H2,(H,19,20)/t10-,11+/m1/s1 |
| InChIKey | CYDAGAGUCKAIHU-MNOVXSKESA-N |
| XLogP | 2.72 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|