C17H24N6O3 — CID 126471335
3-(2,4-dimethoxypyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine (PubChem CID 126471335) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-(2,4-dimethoxypyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine.
| Compound Name | 3-(2,4-dimethoxypyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 126471335 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 3-(2,4-dimethoxypyrimidin-5-yl)-N-(3-morpholin-4-ylpropyl)pyrazin-2-amine |
| SMILES | COc1ncc(-c2nccnc2NCCCN2CCOCC2)c(OC)n1 |
| InChI | InChI=1S/C17H24N6O3/c1-24-16-13(12-21-17(22-16)25-2)14-15(20-6-5-18-14)19-4-3-7-23-8-10-26-11-9-23/h5-6,12H,3-4,7-11H2,1-2H3,(H,19,20) |
| InChIKey | MOOCDEFZWREZFH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|