C15H21N3O3 — CID 126472992
N-(2,2-dimethoxyethyl)-N,2,6-trimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 126472992) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N,2,6-trimethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N,2,6-trimethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126472992 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N,2,6-trimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | COC(CN(C)C(=O)c1c(C)nc2ccc(C)cn12)OC |
| InChI | InChI=1S/C15H21N3O3/c1-10-6-7-12-16-11(2)14(18(12)8-10)15(19)17(3)9-13(20-4)21-5/h6-8,13H,9H2,1-5H3 |
| InChIKey | JQQBPFBRRODHHW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|