C13H17N3O3 — CID 126471069
N-(2,2-dimethoxyethyl)-N-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 126471069) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126471069 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | COC(CN(C)C(=O)c1cnc2ccccn12)OC |
| InChI | InChI=1S/C13H17N3O3/c1-15(9-12(18-2)19-3)13(17)10-8-14-11-6-4-5-7-16(10)11/h4-8,12H,9H2,1-3H3 |
| InChIKey | MFBKTQCCGNIDEI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|