C13H17N5O — CID 67261310
N-(piperazin-1-ylmethyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 67261310) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(piperazin-1-ylmethyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(piperazin-1-ylmethyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67261310 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(piperazin-1-ylmethyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | O=C(NCN1CCNCC1)c1cnc2ccccn12 |
| InChI | InChI=1S/C13H17N5O/c19-13(16-10-17-7-4-14-5-8-17)11-9-15-12-3-1-2-6-18(11)12/h1-3,6,9,14H,4-5,7-8,10H2,(H,16,19) |
| InChIKey | XYOJEYUPFXCJKC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |