C13H16N6O — CID 126474497
3-N-(oxan-4-yl)-5-pyrimidin-5-ylpyrazine-2,3-diamine (PubChem CID 126474497) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-N-(oxan-4-yl)-5-pyrimidin-5-ylpyrazine-2,3-diamine.
| Compound Name | 3-N-(oxan-4-yl)-5-pyrimidin-5-ylpyrazine-2,3-diamine |
|---|---|
| PubChem CID | 126474497 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-N-(oxan-4-yl)-5-pyrimidin-5-ylpyrazine-2,3-diamine |
| SMILES | Nc1ncc(-c2cncnc2)nc1NC1CCOCC1 |
| InChI | InChI=1S/C13H16N6O/c14-12-13(18-10-1-3-20-4-2-10)19-11(7-17-12)9-5-15-8-16-6-9/h5-8,10H,1-4H2,(H2,14,17)(H,18,19) |
| InChIKey | COBHUMDARLNFMK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |