C18H19N5O — CID 175892764
2-N-(oxan-4-yl)-3-phenylpyrido[3,4-b]pyrazine-2,5-diamine (PubChem CID 175892764) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-N-(oxan-4-yl)-3-phenylpyrido[3,4-b]pyrazine-2,5-diamine.
| Compound Name | 2-N-(oxan-4-yl)-3-phenylpyrido[3,4-b]pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 175892764 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-N-(oxan-4-yl)-3-phenylpyrido[3,4-b]pyrazine-2,5-diamine |
| SMILES | Nc1nccc2nc(NC3CCOCC3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C18H19N5O/c19-17-16-14(6-9-20-17)22-18(21-13-7-10-24-11-8-13)15(23-16)12-4-2-1-3-5-12/h1-6,9,13H,7-8,10-11H2,(H2,19,20)(H,21,22) |
| InChIKey | CXGHLUAUJQTPOA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |