C21H26ClN5O — CID 126478494
2-benzyl-1,1-dimethyl-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]guanidine chloride (PubChem CID 126478494) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]guanidine chloride.
| Compound Name | 2-benzyl-1,1-dimethyl-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]guanidine chloride |
|---|---|
| PubChem CID | 126478494 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]guanidine chloride |
| SMILES | CC(Cc1ccccc1)[n+]1cc(N/C(=N/Cc2ccccc2)N(C)C)on1.[Cl-] |
| InChI | InChI=1S/C21H26N5O.ClH/c1-17(14-18-10-6-4-7-11-18)26-16-20(27-24-26)23-21(25(2)3)22-15-19-12-8-5-9-13-19;/h4-13,16-17H,14-15H2,1-3H3,(H,22,23);1H/q+1;/p-1 |
| InChIKey | SJJSXGASTPNHLN-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|