C21H24FN3O2S — CID 126479997
N-butyl-2-[(4-fluorophenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide (PubChem CID 126479997) has the molecular formula C21H24FN3O2S and a molecular weight of 401.51 g/mol. Its IUPAC name is N-butyl-2-[(4-fluorophenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide.
| Compound Name | N-butyl-2-[(4-fluorophenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 126479997 |
| Molecular Formula | C21H24FN3O2S |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-butyl-2-[(4-fluorophenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)NC(=O)C(CSCc1ccc(F)cc1)N2 |
| InChI | InChI=1S/C21H24FN3O2S/c1-2-3-10-23-20(26)15-6-9-17-18(11-15)25-21(27)19(24-17)13-28-12-14-4-7-16(22)8-5-14/h4-9,11,19,24H,2-3,10,12-13H2,1H3,(H,23,26)(H,25,27) |
| InChIKey | ABPPZTFTWHDUBH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|