C25H32FN3O2S — CID 98363710
(2R)-2-[(3-fluorophenyl)methylsulfanylmethyl]-N-octyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide (PubChem CID 98363710) has the molecular formula C25H32FN3O2S and a molecular weight of 457.62 g/mol. Its IUPAC name is (2R)-2-[(3-fluorophenyl)methylsulfanylmethyl]-N-octyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide.
| Compound Name | (2R)-2-[(3-fluorophenyl)methylsulfanylmethyl]-N-octyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 98363710 |
| Molecular Formula | C25H32FN3O2S |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (2R)-2-[(3-fluorophenyl)methylsulfanylmethyl]-N-octyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1ccc2c(c1)NC(=O)[C@H](CSCc1cccc(F)c1)N2 |
| InChI | InChI=1S/C25H32FN3O2S/c1-2-3-4-5-6-7-13-27-24(30)19-11-12-21-22(15-19)29-25(31)23(28-21)17-32-16-18-9-8-10-20(26)14-18/h8-12,14-15,23,28H,2-7,13,16-17H2,1H3,(H,27,30)(H,29,31)/t23-/m0/s1 |
| InChIKey | HMVRJFDPIMNQPM-QHCPKHFHSA-N |
| XLogP | 5.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|