C24H31N3O2S — CID 20967543
N-hexyl-2-[(4-methylphenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide (PubChem CID 20967543) has the molecular formula C24H31N3O2S and a molecular weight of 425.60 g/mol. Its IUPAC name is N-hexyl-2-[(4-methylphenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide.
| Compound Name | N-hexyl-2-[(4-methylphenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 20967543 |
| Molecular Formula | C24H31N3O2S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-hexyl-2-[(4-methylphenyl)methylsulfanylmethyl]-3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccc2c(c1)NC(=O)C(CSCc1ccc(C)cc1)N2 |
| InChI | InChI=1S/C24H31N3O2S/c1-3-4-5-6-13-25-23(28)19-11-12-20-21(14-19)27-24(29)22(26-20)16-30-15-18-9-7-17(2)8-10-18/h7-12,14,22,26H,3-6,13,15-16H2,1-2H3,(H,25,28)(H,27,29) |
| InChIKey | VXMHFEKYRCPNBR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|