C41H59N5O4 — CID 126480581
tert-butyl 4-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]benzoate (PubChem CID 126480581) has the molecular formula C41H59N5O4 and a molecular weight of 685.95 g/mol. Its IUPAC name is tert-butyl 4-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]benzoate.
| Compound Name | tert-butyl 4-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]benzoate |
|---|---|
| PubChem CID | 126480581 |
| Molecular Formula | C41H59N5O4 |
| Molecular Weight | 685.95 g/mol |
| Exact Mass | 685.46 |
| IUPAC Name | tert-butyl 4-[2,5-bis[4-(2-pyrrolidin-1-ylethyl)piperidine-1-carbonyl]anilino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Nc2cc(C(=O)N3CCC(CCN4CCCC4)CC3)ccc2C(=O)N2CCC(CCN3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C41H59N5O4/c1-41(2,3)50-40(49)33-8-11-35(12-9-33)42-37-30-34(38(47)45-26-16-31(17-27-45)14-24-43-20-4-5-21-43)10-13-36(37)39(48)46-28-18-32(19-29-46)15-25-44-22-6-7-23-44/h8-13,30-32,42H,4-7,14-29H2,1-3H3 |
| InChIKey | BZEGQUXXRLLPMG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.95 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |