C37H51N5O4 — CID 126480583
tert-butyl 4-[2,5-bis(4-pyrrolidin-1-ylpiperidine-1-carbonyl)anilino]benzoate (PubChem CID 126480583) has the molecular formula C37H51N5O4 and a molecular weight of 629.85 g/mol. Its IUPAC name is tert-butyl 4-[2,5-bis(4-pyrrolidin-1-ylpiperidine-1-carbonyl)anilino]benzoate.
| Compound Name | tert-butyl 4-[2,5-bis(4-pyrrolidin-1-ylpiperidine-1-carbonyl)anilino]benzoate |
|---|---|
| PubChem CID | 126480583 |
| Molecular Formula | C37H51N5O4 |
| Molecular Weight | 629.85 g/mol |
| Exact Mass | 629.39 |
| IUPAC Name | tert-butyl 4-[2,5-bis(4-pyrrolidin-1-ylpiperidine-1-carbonyl)anilino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Nc2cc(C(=O)N3CCC(N4CCCC4)CC3)ccc2C(=O)N2CCC(N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C37H51N5O4/c1-37(2,3)46-36(45)27-8-11-29(12-9-27)38-33-26-28(34(43)41-22-14-30(15-23-41)39-18-4-5-19-39)10-13-32(33)35(44)42-24-16-31(17-25-42)40-20-6-7-21-40/h8-13,26,30-31,38H,4-7,14-25H2,1-3H3 |
| InChIKey | TUYLVIRGYHIJJT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.85 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |