C30H31FO4 — CID 126481507
(2R)-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-fluoro-1-trityloxybut-3-en-2-ol (PubChem CID 126481507) has the molecular formula C30H31FO4 and a molecular weight of 474.57 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-fluoro-1-trityloxybut-3-en-2-ol.
| Compound Name | (2R)-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-fluoro-1-trityloxybut-3-en-2-ol |
|---|---|
| PubChem CID | 126481507 |
| Molecular Formula | C30H31FO4 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (2R)-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-fluoro-1-trityloxybut-3-en-2-ol |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@](O)(COC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=C)F |
| InChI | InChI=1S/C30H31FO4/c1-5-26-27(35-28(3,4)34-26)29(32,22(2)31)21-33-30(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h5-20,26-27,32H,1-2,21H2,3-4H3/t26-,27-,29-/m0/s1 |
| InChIKey | CBBVOIRLONBXQX-YCVJPRETSA-N |
| XLogP | 5.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|