C17H16F2O3 — CID 42609841
(2R,3S,5R)-2,3-bis(4-fluorophenyl)-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 42609841) has the molecular formula C17H16F2O3 and a molecular weight of 306.31 g/mol. Its IUPAC name is (2R,3S,5R)-2,3-bis(4-fluorophenyl)-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2,3-bis(4-fluorophenyl)-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 42609841 |
| Molecular Formula | C17H16F2O3 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (2R,3S,5R)-2,3-bis(4-fluorophenyl)-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1C[C@](O)(c2ccc(F)cc2)[C@@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C17H16F2O3/c18-13-5-1-11(2-6-13)16-17(21,9-15(10-20)22-16)12-3-7-14(19)8-4-12/h1-8,15-16,20-21H,9-10H2/t15-,16-,17+/m1/s1 |
| InChIKey | PKQIINYYWQVQMM-ZACQAIPSSA-N |
| XLogP | 2.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |