C15H22NO6P — CID 126482324
methyl 4-acetamido-3-(diethoxyphosphorylmethyl)benzoate (PubChem CID 126482324) has the molecular formula C15H22NO6P and a molecular weight of 343.32 g/mol. Its IUPAC name is methyl 4-acetamido-3-(diethoxyphosphorylmethyl)benzoate.
| Compound Name | methyl 4-acetamido-3-(diethoxyphosphorylmethyl)benzoate |
|---|---|
| PubChem CID | 126482324 |
| Molecular Formula | C15H22NO6P |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | methyl 4-acetamido-3-(diethoxyphosphorylmethyl)benzoate |
| SMILES | CCOP(=O)(Cc1cc(C(=O)OC)ccc1NC(C)=O)OCC |
| InChI | InChI=1S/C15H22NO6P/c1-5-21-23(19,22-6-2)10-13-9-12(15(18)20-4)7-8-14(13)16-11(3)17/h7-9H,5-6,10H2,1-4H3,(H,16,17) |
| InChIKey | HANOMSCYYABQKM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|