C14H20NO6P — CID 87383699
methyl 4-[(2-diethoxyphosphorylacetyl)amino]benzoate (PubChem CID 87383699) has the molecular formula C14H20NO6P and a molecular weight of 329.29 g/mol. Its IUPAC name is methyl 4-[(2-diethoxyphosphorylacetyl)amino]benzoate.
| Compound Name | methyl 4-[(2-diethoxyphosphorylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 87383699 |
| Molecular Formula | C14H20NO6P |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | methyl 4-[(2-diethoxyphosphorylacetyl)amino]benzoate |
| SMILES | CCOP(=O)(CC(=O)Nc1ccc(C(=O)OC)cc1)OCC |
| InChI | InChI=1S/C14H20NO6P/c1-4-20-22(18,21-5-2)10-13(16)15-12-8-6-11(7-9-12)14(17)19-3/h6-9H,4-5,10H2,1-3H3,(H,15,16) |
| InChIKey | JOGKTPQCBGZDAZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|