C16H25N2O9P — CID 89141094
[4-[(2-diethoxyphosphorylacetyl)amino]phenyl] 4-(dihydroxyamino)oxybutanoate (PubChem CID 89141094) has the molecular formula C16H25N2O9P and a molecular weight of 420.36 g/mol. Its IUPAC name is [4-[(2-diethoxyphosphorylacetyl)amino]phenyl] 4-(dihydroxyamino)oxybutanoate.
| Compound Name | [4-[(2-diethoxyphosphorylacetyl)amino]phenyl] 4-(dihydroxyamino)oxybutanoate |
|---|---|
| PubChem CID | 89141094 |
| Molecular Formula | C16H25N2O9P |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [4-[(2-diethoxyphosphorylacetyl)amino]phenyl] 4-(dihydroxyamino)oxybutanoate |
| SMILES | CCOP(=O)(CC(=O)Nc1ccc(OC(=O)CCCON(O)O)cc1)OCC |
| InChI | InChI=1S/C16H25N2O9P/c1-3-25-28(23,26-4-2)12-15(19)17-13-7-9-14(10-8-13)27-16(20)6-5-11-24-18(21)22/h7-10,21-22H,3-6,11-12H2,1-2H3,(H,17,19) |
| InChIKey | AHBSEJAFPGBCBT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|