C13H19N2O6P — CID 175058324
[2-[(2-diethoxyphosphorylacetyl)amino]phenyl] carbamate (PubChem CID 175058324) has the molecular formula C13H19N2O6P and a molecular weight of 330.28 g/mol. Its IUPAC name is [2-[(2-diethoxyphosphorylacetyl)amino]phenyl] carbamate.
| Compound Name | [2-[(2-diethoxyphosphorylacetyl)amino]phenyl] carbamate |
|---|---|
| PubChem CID | 175058324 |
| Molecular Formula | C13H19N2O6P |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [2-[(2-diethoxyphosphorylacetyl)amino]phenyl] carbamate |
| SMILES | CCOP(=O)(CC(=O)Nc1ccccc1OC(N)=O)OCC |
| InChI | InChI=1S/C13H19N2O6P/c1-3-19-22(18,20-4-2)9-12(16)15-10-7-5-6-8-11(10)21-13(14)17/h5-8H,3-4,9H2,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | ZUWPOSXNNDLRLD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|