C27H46N4O14 — CID 89255390
[4-[2-[6-(dihydroxyamino)oxyhexanoylamino]-3-[6-(dihydroxyamino)oxyhexoxy]-3-oxopropyl]phenyl] 6-(dihydroxyamino)oxyhexanoate (PubChem CID 89255390) has the molecular formula C27H46N4O14 and a molecular weight of 650.68 g/mol. Its IUPAC name is [4-[2-[6-(dihydroxyamino)oxyhexanoylamino]-3-[6-(dihydroxyamino)oxyhexoxy]-3-oxopropyl]phenyl] 6-(dihydroxyamino)oxyhexanoate.
| Compound Name | [4-[2-[6-(dihydroxyamino)oxyhexanoylamino]-3-[6-(dihydroxyamino)oxyhexoxy]-3-oxopropyl]phenyl] 6-(dihydroxyamino)oxyhexanoate |
|---|---|
| PubChem CID | 89255390 |
| Molecular Formula | C27H46N4O14 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | [4-[2-[6-(dihydroxyamino)oxyhexanoylamino]-3-[6-(dihydroxyamino)oxyhexoxy]-3-oxopropyl]phenyl] 6-(dihydroxyamino)oxyhexanoate |
| SMILES | O=C(CCCCCON(O)O)NC(Cc1ccc(OC(=O)CCCCCON(O)O)cc1)C(=O)OCCCCCCON(O)O |
| InChI | InChI=1S/C27H46N4O14/c32-25(11-5-3-9-19-43-30(37)38)28-24(27(34)41-17-7-1-2-8-18-42-29(35)36)21-22-13-15-23(16-14-22)45-26(33)12-6-4-10-20-44-31(39)40/h13-16,24,35-40H,1-12,17-21H2,(H,28,32) |
| InChIKey | DGBLFMNHUBLYKL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 240.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|