C28H40NO7P — CID 20657048
hexyl 3-[4-[ethoxy(methyl)phosphoryl]oxyphenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate (PubChem CID 20657048) has the molecular formula C28H40NO7P and a molecular weight of 533.60 g/mol. Its IUPAC name is hexyl 3-[4-[ethoxy(methyl)phosphoryl]oxyphenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate.
| Compound Name | hexyl 3-[4-[ethoxy(methyl)phosphoryl]oxyphenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 20657048 |
| Molecular Formula | C28H40NO7P |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | hexyl 3-[4-[ethoxy(methyl)phosphoryl]oxyphenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate |
| SMILES | CCCCCCOC(=O)C(Cc1ccc(OP(C)(=O)OCC)cc1)NC(=O)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H40NO7P/c1-5-7-8-9-20-34-28(31)26(29-27(30)19-14-22-10-15-24(33-3)16-11-22)21-23-12-17-25(18-13-23)36-37(4,32)35-6-2/h10-13,15-18,26H,5-9,14,19-21H2,1-4H3,(H,29,30) |
| InChIKey | OZKQKCMIARSUMT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|