C26H33NO9P2V — CID 58651894
diphosphanyl 3-[4-(4-acetyloxybutoxycarbonyloxy)phenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate;vanadium (PubChem CID 58651894) has the molecular formula C26H33NO9P2V and a molecular weight of 616.44 g/mol. Its IUPAC name is diphosphanyl 3-[4-(4-acetyloxybutoxycarbonyloxy)phenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate;vanadium.
| Compound Name | diphosphanyl 3-[4-(4-acetyloxybutoxycarbonyloxy)phenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate;vanadium |
|---|---|
| PubChem CID | 58651894 |
| Molecular Formula | C26H33NO9P2V |
| Molecular Weight | 616.44 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | diphosphanyl 3-[4-(4-acetyloxybutoxycarbonyloxy)phenyl]-2-[3-(4-methoxyphenyl)propanoylamino]propanoate;vanadium |
| SMILES | COc1ccc(CCC(=O)NC(Cc2ccc(OC(=O)OCCCCOC(C)=O)cc2)C(=O)OPP)cc1.[V] |
| InChI | InChI=1S/C26H33NO9P2.V/c1-18(28)33-15-3-4-16-34-26(31)35-22-12-7-20(8-13-22)17-23(25(30)36-38-37)27-24(29)14-9-19-5-10-21(32-2)11-6-19;/h5-8,10-13,23,38H,3-4,9,14-17,37H2,1-2H3,(H,27,29); |
| InChIKey | GYWUFJZUIZEKCC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|