C15H18FNO3 — CID 126482466
ethyl 4-fluoro-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)benzoate (PubChem CID 126482466) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is ethyl 4-fluoro-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)benzoate.
| Compound Name | ethyl 4-fluoro-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)benzoate |
|---|---|
| PubChem CID | 126482466 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | ethyl 4-fluoro-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(F)cc1N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C15H18FNO3/c1-2-19-15(18)13-6-3-10(16)7-14(13)17-8-11-4-5-12(9-17)20-11/h3,6-7,11-12H,2,4-5,8-9H2,1H3 |
| InChIKey | IGBLGYQIFQASEJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |