C10H18N2O8S2 — CID 126482856
(E)-2,3-bis[2-(methanesulfonamido)ethyl]but-2-enedioic acid (PubChem CID 126482856) has the molecular formula C10H18N2O8S2 and a molecular weight of 358.39 g/mol. Its IUPAC name is (E)-2,3-bis[2-(methanesulfonamido)ethyl]but-2-enedioic acid.
| Compound Name | (E)-2,3-bis[2-(methanesulfonamido)ethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 126482856 |
| Molecular Formula | C10H18N2O8S2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (E)-2,3-bis[2-(methanesulfonamido)ethyl]but-2-enedioic acid |
| SMILES | CS(=O)(=O)NCC/C(C(=O)O)=C(/CCNS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O8S2/c1-21(17,18)11-5-3-7(9(13)14)8(10(15)16)4-6-12-22(2,19)20/h11-12H,3-6H2,1-2H3,(H,13,14)(H,15,16)/b8-7+ |
| InChIKey | ZBLUWRZBCLNPJU-BQYQJAHWSA-N |
| XLogP | -1.67 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|