C8H14N2O7S — CID 20769672
2-[3-(methanesulfonamido)propanoylamino]butanedioic acid (PubChem CID 20769672) has the molecular formula C8H14N2O7S and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)propanoylamino]butanedioic acid.
| Compound Name | 2-[3-(methanesulfonamido)propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 20769672 |
| Molecular Formula | C8H14N2O7S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-[3-(methanesulfonamido)propanoylamino]butanedioic acid |
| SMILES | CS(=O)(=O)NCCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O7S/c1-18(16,17)9-3-2-6(11)10-5(8(14)15)4-7(12)13/h5,9H,2-4H2,1H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | LRWWESIWXMXVNR-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |