C16H19NO4S — CID 126483054
4-(3-methylsulfonylphenyl)-1-propylpyridin-1-ium formate (PubChem CID 126483054) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-(3-methylsulfonylphenyl)-1-propylpyridin-1-ium formate.
| Compound Name | 4-(3-methylsulfonylphenyl)-1-propylpyridin-1-ium formate |
|---|---|
| PubChem CID | 126483054 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-(3-methylsulfonylphenyl)-1-propylpyridin-1-ium formate |
| SMILES | CCC[n+]1ccc(-c2cccc(S(C)(=O)=O)c2)cc1.O=C[O-] |
| InChI | InChI=1S/C15H18NO2S.CH2O2/c1-3-9-16-10-7-13(8-11-16)14-5-4-6-15(12-14)19(2,17)18;2-1-3/h4-8,10-12H,3,9H2,1-2H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | OEJQNYXHTALYGU-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|