C14H11NO3S — CID 53220172
2-hydroxy-5-(3-methylsulfonylphenyl)benzonitrile (PubChem CID 53220172) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-hydroxy-5-(3-methylsulfonylphenyl)benzonitrile.
| Compound Name | 2-hydroxy-5-(3-methylsulfonylphenyl)benzonitrile |
|---|---|
| PubChem CID | 53220172 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-hydroxy-5-(3-methylsulfonylphenyl)benzonitrile |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(O)c(C#N)c2)c1 |
| InChI | InChI=1S/C14H11NO3S/c1-19(17,18)13-4-2-3-10(8-13)11-5-6-14(16)12(7-11)9-15/h2-8,16H,1H3 |
| InChIKey | WHBDRKOOHYOGOG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |