C14H11ClN4O3 — CID 126483632
(2-chloropyrimidin-4-yl)-[3-(prop-2-enoylamino)phenyl]carbamic acid (PubChem CID 126483632) has the molecular formula C14H11ClN4O3 and a molecular weight of 318.72 g/mol. Its IUPAC name is (2-chloropyrimidin-4-yl)-[3-(prop-2-enoylamino)phenyl]carbamic acid.
| Compound Name | (2-chloropyrimidin-4-yl)-[3-(prop-2-enoylamino)phenyl]carbamic acid |
|---|---|
| PubChem CID | 126483632 |
| Molecular Formula | C14H11ClN4O3 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (2-chloropyrimidin-4-yl)-[3-(prop-2-enoylamino)phenyl]carbamic acid |
| SMILES | C=CC(=O)Nc1cccc(N(C(=O)O)c2ccnc(Cl)n2)c1 |
| InChI | InChI=1S/C14H11ClN4O3/c1-2-12(20)17-9-4-3-5-10(8-9)19(14(21)22)11-6-7-16-13(15)18-11/h2-8H,1H2,(H,17,20)(H,21,22) |
| InChIKey | XGEZYUITJPNYNE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|