C17H14F2O5 — CID 126483998
3-[4-(difluoromethoxy)phenyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde (PubChem CID 126483998) has the molecular formula C17H14F2O5 and a molecular weight of 336.29 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde |
|---|---|
| PubChem CID | 126483998 |
| Molecular Formula | C17H14F2O5 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde |
| SMILES | COc1cc(C=O)cc2c1OC(c1ccc(OC(F)F)cc1)CO2 |
| InChI | InChI=1S/C17H14F2O5/c1-21-13-6-10(8-20)7-14-16(13)24-15(9-22-14)11-2-4-12(5-3-11)23-17(18)19/h2-8,15,17H,9H2,1H3 |
| InChIKey | GFARURQMUPHQGE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|