C8H7NO4 — CID 141299183
4-methoxy-1,3,2-benzodioxazole-6-carbaldehyde (PubChem CID 141299183) has the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. Its IUPAC name is 4-methoxy-1,3,2-benzodioxazole-6-carbaldehyde.
| Compound Name | 4-methoxy-1,3,2-benzodioxazole-6-carbaldehyde |
|---|---|
| PubChem CID | 141299183 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 4-methoxy-1,3,2-benzodioxazole-6-carbaldehyde |
| SMILES | COc1cc(C=O)cc2c1ONO2 |
| InChI | InChI=1S/C8H7NO4/c1-11-6-2-5(4-10)3-7-8(6)13-9-12-7/h2-4,9H,1H3 |
| InChIKey | OIRQLTNDPBIUQB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|