C10H13ClN4O2 — CID 126486008
N-(6-chloropyrimidin-4-yl)-N-methylmorpholine-2-carboxamide (PubChem CID 126486008) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is N-(6-chloropyrimidin-4-yl)-N-methylmorpholine-2-carboxamide.
| Compound Name | N-(6-chloropyrimidin-4-yl)-N-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 126486008 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(6-chloropyrimidin-4-yl)-N-methylmorpholine-2-carboxamide |
| SMILES | CN(C(=O)C1CNCCO1)c1cc(Cl)ncn1 |
| InChI | InChI=1S/C10H13ClN4O2/c1-15(9-4-8(11)13-6-14-9)10(16)7-5-12-2-3-17-7/h4,6-7,12H,2-3,5H2,1H3 |
| InChIKey | DFZCRBBIRIGSBP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |