C11H15NO3 — CID 126489558
1-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methylbutan-1-one (PubChem CID 126489558) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methylbutan-1-one.
| Compound Name | 1-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 126489558 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-(3-hydroxy-4-methoxy-2-pyridinyl)-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)c1nccc(OC)c1O |
| InChI | InChI=1S/C11H15NO3/c1-4-7(2)10(13)9-11(14)8(15-3)5-6-12-9/h5-7,14H,4H2,1-3H3 |
| InChIKey | VKMQGJGOCZOARM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |