C23H30N4O2 — CID 126490288
(2S)-2-[[1-(2-ethoxyethyl)-6-(4-methylphenyl)benzimidazol-2-yl]methylamino]butanamide (PubChem CID 126490288) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (2S)-2-[[1-(2-ethoxyethyl)-6-(4-methylphenyl)benzimidazol-2-yl]methylamino]butanamide.
| Compound Name | (2S)-2-[[1-(2-ethoxyethyl)-6-(4-methylphenyl)benzimidazol-2-yl]methylamino]butanamide |
|---|---|
| PubChem CID | 126490288 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (2S)-2-[[1-(2-ethoxyethyl)-6-(4-methylphenyl)benzimidazol-2-yl]methylamino]butanamide |
| SMILES | CCOCCn1c(CN[C@@H](CC)C(N)=O)nc2ccc(-c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C23H30N4O2/c1-4-19(23(24)28)25-15-22-26-20-11-10-18(17-8-6-16(3)7-9-17)14-21(20)27(22)12-13-29-5-2/h6-11,14,19,25H,4-5,12-13,15H2,1-3H3,(H2,24,28)/t19-/m0/s1 |
| InChIKey | PAPHHQNYPJOXRM-IBGZPJMESA-N |
| XLogP | 3.40 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|