C23H26FN3O3 — CID 143688058
2-[[1-(2-ethoxyethyl)-6-(4-fluorophenyl)-2-oxoquinolin-3-yl]methylamino]propanamide (PubChem CID 143688058) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-[[1-(2-ethoxyethyl)-6-(4-fluorophenyl)-2-oxoquinolin-3-yl]methylamino]propanamide.
| Compound Name | 2-[[1-(2-ethoxyethyl)-6-(4-fluorophenyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 143688058 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[[1-(2-ethoxyethyl)-6-(4-fluorophenyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
| SMILES | CCOCCn1c(=O)c(CNC(C)C(N)=O)cc2cc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C23H26FN3O3/c1-3-30-11-10-27-21-9-6-17(16-4-7-20(24)8-5-16)12-18(21)13-19(23(27)29)14-26-15(2)22(25)28/h4-9,12-13,15,26H,3,10-11,14H2,1-2H3,(H2,25,28) |
| InChIKey | ATHFXNAPJMPREV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|