C24H27N3O5 — CID 143688188
(2S)-2-[[7-(1,3-benzodioxol-5-yl)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide (PubChem CID 143688188) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is (2S)-2-[[7-(1,3-benzodioxol-5-yl)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide.
| Compound Name | (2S)-2-[[7-(1,3-benzodioxol-5-yl)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 143688188 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (2S)-2-[[7-(1,3-benzodioxol-5-yl)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
| SMILES | CCOCCn1c(=O)c(CN[C@@H](C)C(N)=O)cc2ccc(-c3ccc4c(c3)OCO4)cc21 |
| InChI | InChI=1S/C24H27N3O5/c1-3-30-9-8-27-20-11-16(17-6-7-21-22(12-17)32-14-31-21)4-5-18(20)10-19(24(27)29)13-26-15(2)23(25)28/h4-7,10-12,15,26H,3,8-9,13-14H2,1-2H3,(H2,25,28)/t15-/m0/s1 |
| InChIKey | VTSRFNYOJAWFPZ-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|