C18H22N4O3 — CID 143688133
(2S)-2-[[7-cyano-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide (PubChem CID 143688133) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2S)-2-[[7-cyano-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide.
| Compound Name | (2S)-2-[[7-cyano-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 143688133 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2S)-2-[[7-cyano-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
| SMILES | CCOCCn1c(=O)c(CN[C@@H](C)C(N)=O)cc2ccc(C#N)cc21 |
| InChI | InChI=1S/C18H22N4O3/c1-3-25-7-6-22-16-8-13(10-19)4-5-14(16)9-15(18(22)24)11-21-12(2)17(20)23/h4-5,8-9,12,21H,3,6-7,11H2,1-2H3,(H2,20,23)/t12-/m0/s1 |
| InChIKey | UNFMENBVCUGJFD-LBPRGKRZSA-N |
| XLogP | 0.87 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|