C23H26ClN3O4 — CID 143687973
2-[[7-(3-chlorophenoxy)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide (PubChem CID 143687973) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is 2-[[7-(3-chlorophenoxy)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide.
| Compound Name | 2-[[7-(3-chlorophenoxy)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 143687973 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[[7-(3-chlorophenoxy)-1-(2-ethoxyethyl)-2-oxoquinolin-3-yl]methylamino]propanamide |
| SMILES | CCOCCn1c(=O)c(CNC(C)C(N)=O)cc2ccc(Oc3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C23H26ClN3O4/c1-3-30-10-9-27-21-13-20(31-19-6-4-5-18(24)12-19)8-7-16(21)11-17(23(27)29)14-26-15(2)22(25)28/h4-8,11-13,15,26H,3,9-10,14H2,1-2H3,(H2,25,28) |
| InChIKey | ZEAHQXNYVMDWJY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|