C24H20ClN3O3 — CID 163359187
N-[[7-chloro-2-oxo-1-(2-phenoxyethyl)quinolin-3-yl]methyl]pyridine-2-carboxamide (PubChem CID 163359187) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is N-[[7-chloro-2-oxo-1-(2-phenoxyethyl)quinolin-3-yl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[7-chloro-2-oxo-1-(2-phenoxyethyl)quinolin-3-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163359187 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[[7-chloro-2-oxo-1-(2-phenoxyethyl)quinolin-3-yl]methyl]pyridine-2-carboxamide |
| SMILES | O=C(NCc1cc2ccc(Cl)cc2n(CCOc2ccccc2)c1=O)c1ccccn1 |
| InChI | InChI=1S/C24H20ClN3O3/c25-19-10-9-17-14-18(16-27-23(29)21-8-4-5-11-26-21)24(30)28(22(17)15-19)12-13-31-20-6-2-1-3-7-20/h1-11,14-15H,12-13,16H2,(H,27,29) |
| InChIKey | NBDVPQDDSRUHJC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |