C29H33ClN2O3 — CID 170086144
7-chloro-3-[[[(2Z,3Z,5E)-5-methoxy-2-propylidenehepta-3,5-dienyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one (PubChem CID 170086144) has the molecular formula C29H33ClN2O3 and a molecular weight of 493.05 g/mol. Its IUPAC name is 7-chloro-3-[[[(2Z,3Z,5E)-5-methoxy-2-propylidenehepta-3,5-dienyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one.
| Compound Name | 7-chloro-3-[[[(2Z,3Z,5E)-5-methoxy-2-propylidenehepta-3,5-dienyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one |
|---|---|
| PubChem CID | 170086144 |
| Molecular Formula | C29H33ClN2O3 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 7-chloro-3-[[[(2Z,3Z,5E)-5-methoxy-2-propylidenehepta-3,5-dienyl]amino]methyl]-1-(2-phenoxyethyl)quinolin-2-one |
| SMILES | C/C=C(\C=C/C(=C/CC)CNCc1cc2ccc(Cl)cc2n(CCOc2ccccc2)c1=O)OC |
| InChI | InChI=1S/C29H33ClN2O3/c1-4-9-22(12-15-26(5-2)34-3)20-31-21-24-18-23-13-14-25(30)19-28(23)32(29(24)33)16-17-35-27-10-7-6-8-11-27/h5-15,18-19,31H,4,16-17,20-21H2,1-3H3/b15-12-,22-9-,26-5+ |
| InChIKey | CKMXVAHEFBCUBF-VVPSXORPSA-N |
| XLogP | 6.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|