C26H27ClN2O3 — CID 169128487
7-chloro-N-(2-methylidenebut-3-enyl)-2-oxo-1-(2-phenoxyethyl)quinoline-3-carboxamide;prop-1-ene (PubChem CID 169128487) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is 7-chloro-N-(2-methylidenebut-3-enyl)-2-oxo-1-(2-phenoxyethyl)quinoline-3-carboxamide;prop-1-ene.
| Compound Name | 7-chloro-N-(2-methylidenebut-3-enyl)-2-oxo-1-(2-phenoxyethyl)quinoline-3-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 169128487 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 7-chloro-N-(2-methylidenebut-3-enyl)-2-oxo-1-(2-phenoxyethyl)quinoline-3-carboxamide;prop-1-ene |
| SMILES | C=CC.C=CC(=C)CNC(=O)c1cc2ccc(Cl)cc2n(CCOc2ccccc2)c1=O |
| InChI | InChI=1S/C23H21ClN2O3.C3H6/c1-3-16(2)15-25-22(27)20-13-17-9-10-18(24)14-21(17)26(23(20)28)11-12-29-19-7-5-4-6-8-19;1-3-2/h3-10,13-14H,1-2,11-12,15H2,(H,25,27);3H,1H2,2H3 |
| InChIKey | IODQAJIWRMPORE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|