C25H24ClNO3 — CID 169128453
7-chloro-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]-1-(2-phenoxyethyl)quinolin-2-one (PubChem CID 169128453) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is 7-chloro-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]-1-(2-phenoxyethyl)quinolin-2-one.
| Compound Name | 7-chloro-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]-1-(2-phenoxyethyl)quinolin-2-one |
|---|---|
| PubChem CID | 169128453 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 7-chloro-3-[[(2E)-2-ethenylpenta-2,4-dienoxy]methyl]-1-(2-phenoxyethyl)quinolin-2-one |
| SMILES | C=C/C=C(\C=C)COCc1cc2ccc(Cl)cc2n(CCOc2ccccc2)c1=O |
| InChI | InChI=1S/C25H24ClNO3/c1-3-8-19(4-2)17-29-18-21-15-20-11-12-22(26)16-24(20)27(25(21)28)13-14-30-23-9-6-5-7-10-23/h3-12,15-16H,1-2,13-14,17-18H2/b19-8+ |
| InChIKey | XLLZOKSIRQQVJB-UFWORHAWSA-N |
| XLogP | 5.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|